C45H45Br4N — CID 159894360
N,N-bis(4-bromophenyl)-4-butan-2-ylaniline;2,7-dibromo-9,9-bis(pent-4-enyl)fluorene (PubChem CID 159894360) has the molecular formula C45H45Br4N and a molecular weight of 919.48 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-4-butan-2-ylaniline;2,7-dibromo-9,9-bis(pent-4-enyl)fluorene.
| Compound Name | N,N-bis(4-bromophenyl)-4-butan-2-ylaniline;2,7-dibromo-9,9-bis(pent-4-enyl)fluorene |
|---|---|
| PubChem CID | 159894360 |
| Molecular Formula | C45H45Br4N |
| Molecular Weight | 919.48 g/mol |
| Exact Mass | 915.03 |
| IUPAC Name | N,N-bis(4-bromophenyl)-4-butan-2-ylaniline;2,7-dibromo-9,9-bis(pent-4-enyl)fluorene |
| SMILES | C=CCCCC1(CCCC=C)c2cc(Br)ccc2-c2ccc(Br)cc21.CCC(C)c1ccc(N(c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H24Br2.C22H21Br2N/c1-3-5-7-13-23(14-8-6-4-2)21-15-17(24)9-11-19(21)20-12-10-18(25)16-22(20)23;1-3-16(2)17-4-10-20(11-5-17)25(21-12-6-18(23)7-13-21)22-14-8-19(24)9-15-22/h3-4,9-12,15-16H,1-2,5-8,13-14H2;4-16H,3H2,1-2H3 |
| InChIKey | NVDQMHKIZZLQCB-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.48 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|