C57H60N2 — CID 91347233
2-N,2-N,11-N-tris(4-tert-butylphenyl)-11-N-(4-propan-2-ylphenyl)benzo[c]phenanthrene-2,11-diamine (PubChem CID 91347233) has the molecular formula C57H60N2 and a molecular weight of 773.12 g/mol. Its IUPAC name is 2-N,2-N,11-N-tris(4-tert-butylphenyl)-11-N-(4-propan-2-ylphenyl)benzo[c]phenanthrene-2,11-diamine.
| Compound Name | 2-N,2-N,11-N-tris(4-tert-butylphenyl)-11-N-(4-propan-2-ylphenyl)benzo[c]phenanthrene-2,11-diamine |
|---|---|
| PubChem CID | 91347233 |
| Molecular Formula | C57H60N2 |
| Molecular Weight | 773.12 g/mol |
| Exact Mass | 772.48 |
| IUPAC Name | 2-N,2-N,11-N-tris(4-tert-butylphenyl)-11-N-(4-propan-2-ylphenyl)benzo[c]phenanthrene-2,11-diamine |
| SMILES | CC(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3ccc4ccc5ccc(N(c6ccc(C(C)(C)C)cc6)c6ccc(C(C)(C)C)cc6)cc5c4c3c2)cc1 |
| InChI | InChI=1S/C57H60N2/c1-38(2)39-16-26-46(27-17-39)58(47-30-20-43(21-31-47)55(3,4)5)50-28-18-40-12-14-42-15-13-41-19-29-51(37-53(41)54(42)52(40)36-50)59(48-32-22-44(23-33-48)56(6,7)8)49-34-24-45(25-35-49)57(9,10)11/h12-38H,1-11H3 |
| InChIKey | XJZKEFICAXGKLK-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.12 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|