C23H36N2 — CID 159098824
4-tert-butyl-N,N-dimethylaniline;N,N-dimethyl-4-propan-2-ylaniline (PubChem CID 159098824) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethylaniline;N,N-dimethyl-4-propan-2-ylaniline.
| Compound Name | 4-tert-butyl-N,N-dimethylaniline;N,N-dimethyl-4-propan-2-ylaniline |
|---|---|
| PubChem CID | 159098824 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 4-tert-butyl-N,N-dimethylaniline;N,N-dimethyl-4-propan-2-ylaniline |
| SMILES | CC(C)c1ccc(N(C)C)cc1.CN(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H19N.C11H17N/c1-12(2,3)10-6-8-11(9-7-10)13(4)5;1-9(2)10-5-7-11(8-6-10)12(3)4/h6-9H,1-5H3;5-9H,1-4H3 |
| InChIKey | KDAAIBGHMJVBIO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|