C60H66N2 — CID 59793019
6-N,12-N-bis(4-tert-butylphenyl)-6-N,12-N-bis(3,4-dimethylphenyl)-3,9-di(propan-2-yl)chrysene-6,12-diamine (PubChem CID 59793019) has the molecular formula C60H66N2 and a molecular weight of 815.20 g/mol. Its IUPAC name is 6-N,12-N-bis(4-tert-butylphenyl)-6-N,12-N-bis(3,4-dimethylphenyl)-3,9-di(propan-2-yl)chrysene-6,12-diamine.
| Compound Name | 6-N,12-N-bis(4-tert-butylphenyl)-6-N,12-N-bis(3,4-dimethylphenyl)-3,9-di(propan-2-yl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 59793019 |
| Molecular Formula | C60H66N2 |
| Molecular Weight | 815.20 g/mol |
| Exact Mass | 814.52 |
| IUPAC Name | 6-N,12-N-bis(4-tert-butylphenyl)-6-N,12-N-bis(3,4-dimethylphenyl)-3,9-di(propan-2-yl)chrysene-6,12-diamine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc3c4cc(C(C)C)ccc4c(N(c4ccc(C(C)(C)C)cc4)c4ccc(C)c(C)c4)cc3c3cc(C(C)C)ccc23)cc1C |
| InChI | InChI=1S/C60H66N2/c1-37(2)43-17-29-51-53(33-43)55-35-58(62(50-24-16-40(6)42(8)32-50)48-27-21-46(22-28-48)60(12,13)14)52-30-18-44(38(3)4)34-54(52)56(55)36-57(51)61(49-23-15-39(5)41(7)31-49)47-25-19-45(20-26-47)59(9,10)11/h15-38H,1-14H3 |
| InChIKey | DBMLWWRAXNIIIM-UHFFFAOYSA-N |
| XLogP | 18.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.20 |
| LogP ≤ 5 | 18.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|