C56H54N2 — CID 161166677
N-(4-tert-butylphenyl)-12-[(4-tert-butylphenyl)-(3,4-dimethylphenyl)methyl]-N-(3,4-dimethylphenyl)-3-isocyanochrysen-6-amine (PubChem CID 161166677) has the molecular formula C56H54N2 and a molecular weight of 755.06 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-12-[(4-tert-butylphenyl)-(3,4-dimethylphenyl)methyl]-N-(3,4-dimethylphenyl)-3-isocyanochrysen-6-amine.
| Compound Name | N-(4-tert-butylphenyl)-12-[(4-tert-butylphenyl)-(3,4-dimethylphenyl)methyl]-N-(3,4-dimethylphenyl)-3-isocyanochrysen-6-amine |
|---|---|
| PubChem CID | 161166677 |
| Molecular Formula | C56H54N2 |
| Molecular Weight | 755.06 g/mol |
| Exact Mass | 754.43 |
| IUPAC Name | N-(4-tert-butylphenyl)-12-[(4-tert-butylphenyl)-(3,4-dimethylphenyl)methyl]-N-(3,4-dimethylphenyl)-3-isocyanochrysen-6-amine |
| SMILES | [C-]#[N+]c1ccc2c(C(c3ccc(C(C)(C)C)cc3)c3ccc(C)c(C)c3)cc3c4ccccc4c(N(c4ccc(C(C)(C)C)cc4)c4ccc(C)c(C)c4)cc3c2c1 |
| InChI | InChI=1S/C56H54N2/c1-35-16-18-40(30-37(35)3)54(39-19-21-41(22-20-39)55(5,6)7)52-33-50-46-14-12-13-15-48(46)53(34-51(50)49-32-43(57-11)25-29-47(49)52)58(45-26-17-36(2)38(4)31-45)44-27-23-42(24-28-44)56(8,9)10/h12-34,54H,1-10H3 |
| InChIKey | BVBFICCODUXROF-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.06 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|