C54H54N2 — CID 58599792
6-N-(3-tert-butylphenyl)-12-N-(3,5-dimethylphenyl)-6-N,12-N-bis(4-propan-2-ylphenyl)chrysene-6,12-diamine (PubChem CID 58599792) has the molecular formula C54H54N2 and a molecular weight of 731.04 g/mol. Its IUPAC name is 6-N-(3-tert-butylphenyl)-12-N-(3,5-dimethylphenyl)-6-N,12-N-bis(4-propan-2-ylphenyl)chrysene-6,12-diamine.
| Compound Name | 6-N-(3-tert-butylphenyl)-12-N-(3,5-dimethylphenyl)-6-N,12-N-bis(4-propan-2-ylphenyl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 58599792 |
| Molecular Formula | C54H54N2 |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.43 |
| IUPAC Name | 6-N-(3-tert-butylphenyl)-12-N-(3,5-dimethylphenyl)-6-N,12-N-bis(4-propan-2-ylphenyl)chrysene-6,12-diamine |
| SMILES | Cc1cc(C)cc(N(c2ccc(C(C)C)cc2)c2cc3c4ccccc4c(N(c4ccc(C(C)C)cc4)c4cccc(C(C)(C)C)c4)cc3c3ccccc23)c1 |
| InChI | InChI=1S/C54H54N2/c1-35(2)39-21-25-42(26-22-39)55(44-16-14-15-41(32-44)54(7,8)9)52-33-50-47-18-11-13-20-49(47)53(34-51(50)46-17-10-12-19-48(46)52)56(45-30-37(5)29-38(6)31-45)43-27-23-40(24-28-43)36(3)4/h10-36H,1-9H3 |
| InChIKey | YDLSHHPDJZJLDT-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|