C48H46F6N2 — CID 143635406
N-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-[4-(3-methylpentan-3-yl)phenyl]anilino)phenyl]propan-2-yl]phenyl]-N-phenyl-4-propylaniline (PubChem CID 143635406) has the molecular formula C48H46F6N2 and a molecular weight of 764.90 g/mol. Its IUPAC name is N-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-[4-(3-methylpentan-3-yl)phenyl]anilino)phenyl]propan-2-yl]phenyl]-N-phenyl-4-propylaniline.
| Compound Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-[4-(3-methylpentan-3-yl)phenyl]anilino)phenyl]propan-2-yl]phenyl]-N-phenyl-4-propylaniline |
|---|---|
| PubChem CID | 143635406 |
| Molecular Formula | C48H46F6N2 |
| Molecular Weight | 764.90 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-[4-(3-methylpentan-3-yl)phenyl]anilino)phenyl]propan-2-yl]phenyl]-N-phenyl-4-propylaniline |
| SMILES | CCCc1ccc(N(c2ccccc2)c2ccc(C(c3ccc(N(c4ccccc4)c4ccc(C(C)(CC)CC)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C48H46F6N2/c1-5-14-35-19-27-41(28-20-35)55(39-15-10-8-11-16-39)43-31-23-37(24-32-43)46(47(49,50)51,48(52,53)54)38-25-33-44(34-26-38)56(40-17-12-9-13-18-40)42-29-21-36(22-30-42)45(4,6-2)7-3/h8-13,15-34H,5-7,14H2,1-4H3 |
| InChIKey | PWXOMJPNEVENOY-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.90 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |