C24H26I2O6 — CID 155021636
4,4-bis[4-(2-iodo-2-methylpropanoyl)oxyphenyl]butanoic acid (PubChem CID 155021636) has the molecular formula C24H26I2O6 and a molecular weight of 664.27 g/mol. Its IUPAC name is 4,4-bis[4-(2-iodo-2-methylpropanoyl)oxyphenyl]butanoic acid.
| Compound Name | 4,4-bis[4-(2-iodo-2-methylpropanoyl)oxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 155021636 |
| Molecular Formula | C24H26I2O6 |
| Molecular Weight | 664.27 g/mol |
| Exact Mass | 663.98 |
| IUPAC Name | 4,4-bis[4-(2-iodo-2-methylpropanoyl)oxyphenyl]butanoic acid |
| SMILES | CC(C)(I)C(=O)Oc1ccc(C(CCC(=O)O)c2ccc(OC(=O)C(C)(C)I)cc2)cc1 |
| InChI | InChI=1S/C24H26I2O6/c1-23(2,25)21(29)31-17-9-5-15(6-10-17)19(13-14-20(27)28)16-7-11-18(12-8-16)32-22(30)24(3,4)26/h5-12,19H,13-14H2,1-4H3,(H,27,28) |
| InChIKey | HQJAFNMXSJEGLE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|