C29H27Br3O6 — CID 87221824
[4-[1,1-bis[4-(2-bromopropanoyloxy)phenyl]ethyl]phenyl] 2-bromopropanoate (PubChem CID 87221824) has the molecular formula C29H27Br3O6 and a molecular weight of 711.24 g/mol. Its IUPAC name is [4-[1,1-bis[4-(2-bromopropanoyloxy)phenyl]ethyl]phenyl] 2-bromopropanoate.
| Compound Name | [4-[1,1-bis[4-(2-bromopropanoyloxy)phenyl]ethyl]phenyl] 2-bromopropanoate |
|---|---|
| PubChem CID | 87221824 |
| Molecular Formula | C29H27Br3O6 |
| Molecular Weight | 711.24 g/mol |
| Exact Mass | 707.94 |
| IUPAC Name | [4-[1,1-bis[4-(2-bromopropanoyloxy)phenyl]ethyl]phenyl] 2-bromopropanoate |
| SMILES | CC(Br)C(=O)Oc1ccc(C(C)(c2ccc(OC(=O)C(C)Br)cc2)c2ccc(OC(=O)C(C)Br)cc2)cc1 |
| InChI | InChI=1S/C29H27Br3O6/c1-17(30)26(33)36-23-11-5-20(6-12-23)29(4,21-7-13-24(14-8-21)37-27(34)18(2)31)22-9-15-25(16-10-22)38-28(35)19(3)32/h5-19H,1-4H3 |
| InChIKey | WBOFVIRTCICYEU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.24 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|