C16H28N2O2 — CID 63815315
4-(2-aminopropyl)-N,N-bis(2-methoxyethyl)-3-methylaniline (PubChem CID 63815315) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-(2-aminopropyl)-N,N-bis(2-methoxyethyl)-3-methylaniline.
| Compound Name | 4-(2-aminopropyl)-N,N-bis(2-methoxyethyl)-3-methylaniline |
|---|---|
| PubChem CID | 63815315 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 4-(2-aminopropyl)-N,N-bis(2-methoxyethyl)-3-methylaniline |
| SMILES | COCCN(CCOC)c1ccc(CC(C)N)c(C)c1 |
| InChI | InChI=1S/C16H28N2O2/c1-13-11-16(6-5-15(13)12-14(2)17)18(7-9-19-3)8-10-20-4/h5-6,11,14H,7-10,12,17H2,1-4H3 |
| InChIKey | HCJBSRJLVUQJAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|