C10H12F3N3S — CID 83016392
5-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 83016392) has the molecular formula C10H12F3N3S and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 5-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 83016392 |
| Molecular Formula | C10H12F3N3S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CN(C)Nc1ccc(C(F)(F)F)c(C(N)=S)c1 |
| InChI | InChI=1S/C10H12F3N3S/c1-16(2)15-6-3-4-8(10(11,12)13)7(5-6)9(14)17/h3-5,15H,1-2H3,(H2,14,17) |
| InChIKey | RFACAWLTFKCOGR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|