C12H15F3N2O3S — CID 175090793
5-(tert-butylsulfonylamino)-2-(trifluoromethyl)benzamide (PubChem CID 175090793) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-2-(trifluoromethyl)benzamide.
| Compound Name | 5-(tert-butylsulfonylamino)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175090793 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)S(=O)(=O)Nc1ccc(C(F)(F)F)c(C(N)=O)c1 |
| InChI | InChI=1S/C12H15F3N2O3S/c1-11(2,3)21(19,20)17-7-4-5-9(12(13,14)15)8(6-7)10(16)18/h4-6,17H,1-3H3,(H2,16,18) |
| InChIKey | QHBVUXILPLOZAJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |