C13H19BrFN — CID 107082376
2-(bromomethyl)-N-(2,2-dimethylpropyl)-4-fluoro-N-methylaniline (PubChem CID 107082376) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is 2-(bromomethyl)-N-(2,2-dimethylpropyl)-4-fluoro-N-methylaniline.
| Compound Name | 2-(bromomethyl)-N-(2,2-dimethylpropyl)-4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 107082376 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-(bromomethyl)-N-(2,2-dimethylpropyl)-4-fluoro-N-methylaniline |
| SMILES | CN(CC(C)(C)C)c1ccc(F)cc1CBr |
| InChI | InChI=1S/C13H19BrFN/c1-13(2,3)9-16(4)12-6-5-11(15)7-10(12)8-14/h5-7H,8-9H2,1-4H3 |
| InChIKey | VYVVBXVYYGVLJW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|