C16H18BrN3 — CID 107081859
3-[[3-(bromomethyl)quinolin-2-yl]-propan-2-ylamino]propanenitrile (PubChem CID 107081859) has the molecular formula C16H18BrN3 and a molecular weight of 332.25 g/mol. Its IUPAC name is 3-[[3-(bromomethyl)quinolin-2-yl]-propan-2-ylamino]propanenitrile.
| Compound Name | 3-[[3-(bromomethyl)quinolin-2-yl]-propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 107081859 |
| Molecular Formula | C16H18BrN3 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-[[3-(bromomethyl)quinolin-2-yl]-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)c1nc2ccccc2cc1CBr |
| InChI | InChI=1S/C16H18BrN3/c1-12(2)20(9-5-8-18)16-14(11-17)10-13-6-3-4-7-15(13)19-16/h3-4,6-7,10,12H,5,9,11H2,1-2H3 |
| InChIKey | WERFFHDJMBWMAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|