C18H25BrN2 — CID 107079757
3-(bromomethyl)-N,N-dibutylquinolin-2-amine (PubChem CID 107079757) has the molecular formula C18H25BrN2 and a molecular weight of 349.32 g/mol. Its IUPAC name is 3-(bromomethyl)-N,N-dibutylquinolin-2-amine.
| Compound Name | 3-(bromomethyl)-N,N-dibutylquinolin-2-amine |
|---|---|
| PubChem CID | 107079757 |
| Molecular Formula | C18H25BrN2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-(bromomethyl)-N,N-dibutylquinolin-2-amine |
| SMILES | CCCCN(CCCC)c1nc2ccccc2cc1CBr |
| InChI | InChI=1S/C18H25BrN2/c1-3-5-11-21(12-6-4-2)18-16(14-19)13-15-9-7-8-10-17(15)20-18/h7-10,13H,3-6,11-12,14H2,1-2H3 |
| InChIKey | LCBXSHWWXDDPGO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|