C17H24BrN3 — CID 107085501
N'-[3-(bromomethyl)quinolin-2-yl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine (PubChem CID 107085501) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is N'-[3-(bromomethyl)quinolin-2-yl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[3-(bromomethyl)quinolin-2-yl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107085501 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N'-[3-(bromomethyl)quinolin-2-yl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCN(CCCN(C)C)c1nc2ccccc2cc1CBr |
| InChI | InChI=1S/C17H24BrN3/c1-4-21(11-7-10-20(2)3)17-15(13-18)12-14-8-5-6-9-16(14)19-17/h5-6,8-9,12H,4,7,10-11,13H2,1-3H3 |
| InChIKey | NDMLGMQJYVSJHK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|