C11H14F3N3O2S — CID 79877516
2-[bis(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79877516) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877516 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(C(F)(F)F)nc1N(CCO)CCO |
| InChI | InChI=1S/C11H14F3N3O2S/c12-11(13,14)8-2-1-7(9(15)20)10(16-8)17(3-5-18)4-6-19/h1-2,18-19H,3-6H2,(H2,15,20) |
| InChIKey | QUAXZOXSFUYLTF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|