C11H15BrN2O2S — CID 107277439
4-[bis(2-hydroxyethyl)amino]-2-bromobenzenecarbothioamide (PubChem CID 107277439) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-2-bromobenzenecarbothioamide.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-2-bromobenzenecarbothioamide |
|---|---|
| PubChem CID | 107277439 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-2-bromobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N(CCO)CCO)cc1Br |
| InChI | InChI=1S/C11H15BrN2O2S/c12-10-7-8(1-2-9(10)11(13)17)14(3-5-15)4-6-16/h1-2,7,15-16H,3-6H2,(H2,13,17) |
| InChIKey | MBHKCEGDSXZRKV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|