C15H21BrN2OS — CID 107277590
2-bromo-4-[cyclohexyl(2-hydroxyethyl)amino]benzenecarbothioamide (PubChem CID 107277590) has the molecular formula C15H21BrN2OS and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-bromo-4-[cyclohexyl(2-hydroxyethyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-4-[cyclohexyl(2-hydroxyethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107277590 |
| Molecular Formula | C15H21BrN2OS |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-bromo-4-[cyclohexyl(2-hydroxyethyl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N(CCO)C2CCCCC2)cc1Br |
| InChI | InChI=1S/C15H21BrN2OS/c16-14-10-12(6-7-13(14)15(17)20)18(8-9-19)11-4-2-1-3-5-11/h6-7,10-11,19H,1-5,8-9H2,(H2,17,20) |
| InChIKey | YBVFNWKPDXGXFX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|