C18H31ClN2 — CID 81143688
4-[(tert-butylamino)methyl]-2-chloro-N-(3,3-dimethylbutan-2-yl)-N-methylaniline (PubChem CID 81143688) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-2-chloro-N-(3,3-dimethylbutan-2-yl)-N-methylaniline.
| Compound Name | 4-[(tert-butylamino)methyl]-2-chloro-N-(3,3-dimethylbutan-2-yl)-N-methylaniline |
|---|---|
| PubChem CID | 81143688 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-2-chloro-N-(3,3-dimethylbutan-2-yl)-N-methylaniline |
| SMILES | CC(N(C)c1ccc(CNC(C)(C)C)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C18H31ClN2/c1-13(17(2,3)4)21(8)16-10-9-14(11-15(16)19)12-20-18(5,6)7/h9-11,13,20H,12H2,1-8H3 |
| InChIKey | BQBKYAMCOXLVLA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|