C15H24ClNO — CID 63372657
(1R)-1-[3-chloro-4-[3,3-dimethylbutan-2-yl(methyl)amino]phenyl]ethanol (PubChem CID 63372657) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-[3,3-dimethylbutan-2-yl(methyl)amino]phenyl]ethanol.
| Compound Name | (1R)-1-[3-chloro-4-[3,3-dimethylbutan-2-yl(methyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 63372657 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (1R)-1-[3-chloro-4-[3,3-dimethylbutan-2-yl(methyl)amino]phenyl]ethanol |
| SMILES | CC(N(C)c1ccc([C@@H](C)O)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H24ClNO/c1-10(18)12-7-8-14(13(16)9-12)17(6)11(2)15(3,4)5/h7-11,18H,1-6H3/t10-,11?/m1/s1 |
| InChIKey | BCOMSIWUDVJAPW-NFJWQWPMSA-N |
| XLogP | 4.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|