C15H24ClN3O — CID 106916783
3-[2-chloro-N-methyl-4-(propylaminomethyl)anilino]-N-methylpropanamide (PubChem CID 106916783) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-[2-chloro-N-methyl-4-(propylaminomethyl)anilino]-N-methylpropanamide.
| Compound Name | 3-[2-chloro-N-methyl-4-(propylaminomethyl)anilino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106916783 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-[2-chloro-N-methyl-4-(propylaminomethyl)anilino]-N-methylpropanamide |
| SMILES | CCCNCc1ccc(N(C)CCC(=O)NC)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O/c1-4-8-18-11-12-5-6-14(13(16)10-12)19(3)9-7-15(20)17-2/h5-6,10,18H,4,7-9,11H2,1-3H3,(H,17,20) |
| InChIKey | IYJYGWHNKZLNGU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|