C16H27N3O2 — CID 106916671
3-[4-[(2-methoxyethylamino)methyl]-N,2-dimethylanilino]-N-methylpropanamide (PubChem CID 106916671) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[4-[(2-methoxyethylamino)methyl]-N,2-dimethylanilino]-N-methylpropanamide.
| Compound Name | 3-[4-[(2-methoxyethylamino)methyl]-N,2-dimethylanilino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106916671 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-[4-[(2-methoxyethylamino)methyl]-N,2-dimethylanilino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)c1ccc(CNCCOC)cc1C |
| InChI | InChI=1S/C16H27N3O2/c1-13-11-14(12-18-8-10-21-4)5-6-15(13)19(3)9-7-16(20)17-2/h5-6,11,18H,7-10,12H2,1-4H3,(H,17,20) |
| InChIKey | CMLUVSISHLWKOE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|