C17H27BrClN — CID 107870469
4-(bromomethyl)-2-chloro-N,N-bis(3-methylbutyl)aniline (PubChem CID 107870469) has the molecular formula C17H27BrClN and a molecular weight of 360.77 g/mol. Its IUPAC name is 4-(bromomethyl)-2-chloro-N,N-bis(3-methylbutyl)aniline.
| Compound Name | 4-(bromomethyl)-2-chloro-N,N-bis(3-methylbutyl)aniline |
|---|---|
| PubChem CID | 107870469 |
| Molecular Formula | C17H27BrClN |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-(bromomethyl)-2-chloro-N,N-bis(3-methylbutyl)aniline |
| SMILES | CC(C)CCN(CCC(C)C)c1ccc(CBr)cc1Cl |
| InChI | InChI=1S/C17H27BrClN/c1-13(2)7-9-20(10-8-14(3)4)17-6-5-15(12-18)11-16(17)19/h5-6,11,13-14H,7-10,12H2,1-4H3 |
| InChIKey | OTQXZTKFCLPGHU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|