C14H19BrClNO — CID 123843144
N-[4-(bromomethyl)-2-chlorophenyl]-N-ethyl-2,2-dimethylpropanamide (PubChem CID 123843144) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is N-[4-(bromomethyl)-2-chlorophenyl]-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | N-[4-(bromomethyl)-2-chlorophenyl]-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123843144 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-[4-(bromomethyl)-2-chlorophenyl]-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCN(C(=O)C(C)(C)C)c1ccc(CBr)cc1Cl |
| InChI | InChI=1S/C14H19BrClNO/c1-5-17(13(18)14(2,3)4)12-7-6-10(9-15)8-11(12)16/h6-8H,5,9H2,1-4H3 |
| InChIKey | WPMJXHDSTIQKLH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|