About 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline
4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline (PubChem CID 84781395) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline |
| PubChem CID | 84781395 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2(N)CC2)cc1Cl |
| InChI | InChI=1S/C11H15ClN2/c1-14(2)10-4-3-8(7-9(10)12)11(13)5-6-11/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | CYMDLQJDMCAJJL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline?
The IUPAC name of 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline (CID 84781395) is 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline.
What is the SMILES notation for 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline?
The canonical SMILES for 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline is CN(C)c1ccc(C2(N)CC2)cc1Cl.
What is the InChIKey of 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline?
The InChIKey is CYMDLQJDMCAJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2/c1-14(2)10-4-3-8(7-9(10)12)11(13)5-6-11/h3-4,7H,5-6,13H2,1-2H3.
What are the key properties of 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline?
4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline has a molecular weight of 210.71 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminocyclopropyl)-2-chloro-N,N-dimethylaniline is sourced from PubChem (CID 84781395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).