About N-ethylethanamine;3-fluorobenzaldehyde
N-ethylethanamine;3-fluorobenzaldehyde (PubChem CID 18958425) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is N-ethylethanamine;3-fluorobenzaldehyde.
Molecular Properties
| Compound Name | N-ethylethanamine;3-fluorobenzaldehyde |
| PubChem CID | 18958425 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-ethylethanamine;3-fluorobenzaldehyde |
| SMILES | CCNCC.O=Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H5FO.C4H11N/c8-7-3-1-2-6(4-7)5-9;1-3-5-4-2/h1-5H;5H,3-4H2,1-2H3 |
| InChIKey | SCULXZPNPPGQLO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;3-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;3-fluorobenzaldehyde?
The IUPAC name of N-ethylethanamine;3-fluorobenzaldehyde (CID 18958425) is N-ethylethanamine;3-fluorobenzaldehyde.
What is the SMILES notation for N-ethylethanamine;3-fluorobenzaldehyde?
The canonical SMILES for N-ethylethanamine;3-fluorobenzaldehyde is CCNCC.O=Cc1cccc(F)c1.
What is the InChIKey of N-ethylethanamine;3-fluorobenzaldehyde?
The InChIKey is SCULXZPNPPGQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO.C4H11N/c8-7-3-1-2-6(4-7)5-9;1-3-5-4-2/h1-5H;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;3-fluorobenzaldehyde?
N-ethylethanamine;3-fluorobenzaldehyde has a molecular weight of 197.25 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;3-fluorobenzaldehyde is sourced from PubChem (CID 18958425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).