C23H21Cl2NO5S — CID 16531783
2-(3-chlorophenoxy)ethyl 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 16531783) has the molecular formula C23H21Cl2NO5S and a molecular weight of 494.40 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 16531783 |
| Molecular Formula | C23H21Cl2NO5S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCCOc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H21Cl2NO5S/c1-26(16-17-6-3-2-4-7-17)32(28,29)20-10-11-22(25)21(15-20)23(27)31-13-12-30-19-9-5-8-18(24)14-19/h2-11,14-15H,12-13,16H2,1H3 |
| InChIKey | CGEWVXPGGHKEQH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|