C13H14N2O3S2 — CID 86980048
N,2-dimethyl-5-methylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 86980048) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N,2-dimethyl-5-methylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | N,2-dimethyl-5-methylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86980048 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N,2-dimethyl-5-methylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)N(C)c1nccs1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-9-4-5-10(20(3,17)18)8-11(9)12(16)15(2)13-14-6-7-19-13/h4-8H,1-3H3 |
| InChIKey | APWMKUCRYFUODJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |