C23H21N3O5S — CID 46792804
[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 46792804) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46792804 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O5S/c1-16-12-13-19(32(24,29)30)14-20(16)23(28)31-15-21(27)25-26-22(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-14H,15H2,1H3,(H,25,27)(H2,24,29,30) |
| InChIKey | IIAKIQOJQNWWTL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|