C17H17NO5S2 — CID 31682557
[2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 31682557) has the molecular formula C17H17NO5S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 31682557 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | CSc1ccc(C(=O)COC(=O)c2cc(S(N)(=O)=O)ccc2C)cc1 |
| InChI | InChI=1S/C17H17NO5S2/c1-11-3-8-14(25(18,21)22)9-15(11)17(20)23-10-16(19)12-4-6-13(24-2)7-5-12/h3-9H,10H2,1-2H3,(H2,18,21,22) |
| InChIKey | DIHWWNVLTOSJRG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |