C16H14ClNO5S2 — CID 42983575
[2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 42983575) has the molecular formula C16H14ClNO5S2 and a molecular weight of 399.88 g/mol. Its IUPAC name is [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42983575 |
| Molecular Formula | C16H14ClNO5S2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CSc1ccc(C(=O)COC(=O)c2cc(S(N)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO5S2/c1-24-11-4-2-10(3-5-11)15(19)9-23-16(20)13-8-12(25(18,21)22)6-7-14(13)17/h2-8H,9H2,1H3,(H2,18,21,22) |
| InChIKey | WSZQSVIDYXXYOX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |