C19H20N2O5 — CID 41459030
1-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-(3-methyl-4-nitrophenoxy)ethanone (PubChem CID 41459030) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-(3-methyl-4-nitrophenoxy)ethanone.
| Compound Name | 1-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-(3-methyl-4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 41459030 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-(3-methyl-4-nitrophenoxy)ethanone |
| SMILES | COc1ccc2c(c1)CCCN2C(=O)COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-13-10-16(6-7-17(13)21(23)24)26-12-19(22)20-9-3-4-14-11-15(25-2)5-8-18(14)20/h5-8,10-11H,3-4,9,12H2,1-2H3 |
| InChIKey | RATDJGBCPMZGIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|