C12H16N4O3S2 — CID 43077005
N-ethyl-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 43077005) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-ethyl-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-ethyl-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 43077005 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-ethyl-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCN(C(=O)c2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-2-13-12(20)15-7-5-14(6-8-15)11(17)9-3-4-10(21-9)16(18)19/h3-4H,2,5-8H2,1H3,(H,13,20) |
| InChIKey | VDKSTKBWMIEGPH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|