C14H19Cl2N3S — CID 17284621
N-(2,5-dichlorophenyl)-4-propylpiperazine-1-carbothioamide (PubChem CID 17284621) has the molecular formula C14H19Cl2N3S and a molecular weight of 332.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-propylpiperazine-1-carbothioamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-propylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17284621 |
| Molecular Formula | C14H19Cl2N3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-propylpiperazine-1-carbothioamide |
| SMILES | CCCN1CCN(C(=S)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3S/c1-2-5-18-6-8-19(9-7-18)14(20)17-13-10-11(15)3-4-12(13)16/h3-4,10H,2,5-9H2,1H3,(H,17,20) |
| InChIKey | JDVGSCJVZGLSFX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|