C15H22ClN3O — CID 108995630
2-(3-chloro-2-methylanilino)-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 108995630) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-chloro-2-methylanilino)-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 108995630 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-(3-chloro-2-methylanilino)-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)CNc2cccc(Cl)c2C)CC1 |
| InChI | InChI=1S/C15H22ClN3O/c1-3-18-7-9-19(10-8-18)15(20)11-17-14-6-4-5-13(16)12(14)2/h4-6,17H,3,7-11H2,1-2H3 |
| InChIKey | AFVCRTIOWGBKJE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |