C24H32ClN3O2S — CID 19289555
4-[(3-chlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide (PubChem CID 19289555) has the molecular formula C24H32ClN3O2S and a molecular weight of 462.06 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-[(3-chlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289555 |
| Molecular Formula | C24H32ClN3O2S |
| Molecular Weight | 462.06 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide |
| SMILES | CCOc1ccc(CCNC(=S)N2CCN(Cc3cccc(Cl)c3)CC2)cc1OCC |
| InChI | InChI=1S/C24H32ClN3O2S/c1-3-29-22-9-8-19(17-23(22)30-4-2)10-11-26-24(31)28-14-12-27(13-15-28)18-20-6-5-7-21(25)16-20/h5-9,16-17H,3-4,10-15,18H2,1-2H3,(H,26,31) |
| InChIKey | KGKAHJXVEYSPMB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|