C23H28ClN3O4S — CID 3358743
benzyl 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetate (PubChem CID 3358743) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is benzyl 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 3358743 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | benzyl 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetate |
| SMILES | COc1cc(NC(=S)N2CCCN(CC(=O)OCc3ccccc3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C23H28ClN3O4S/c1-29-20-14-19(21(30-2)13-18(20)24)25-23(32)27-10-6-9-26(11-12-27)15-22(28)31-16-17-7-4-3-5-8-17/h3-5,7-8,13-14H,6,9-12,15-16H2,1-2H3,(H,25,32) |
| InChIKey | JXZZGKMBOHLKIC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|