C19H20N4O2S — CID 126001249
1-tert-butyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea (PubChem CID 126001249) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea.
| Compound Name | 1-tert-butyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea |
|---|---|
| PubChem CID | 126001249 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-tert-butyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea |
| SMILES | CC(C)(C)NC(=S)Nc1ccc2nc3cc4c(cc3nc2c1)OCCO4 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2,3)23-18(26)20-11-4-5-12-13(8-11)22-15-10-17-16(9-14(15)21-12)24-6-7-25-17/h4-5,8-10H,6-7H2,1-3H3,(H2,20,23,26) |
| InChIKey | IFAOIRJBXNPNPK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|