C30H31N3O4 — CID 137030092
tert-butyl N-[1-[4-[5-hydroxy-6-(hydroxyamino)-3-phenylquinolin-2-yl]phenyl]cyclobutyl]carbamate (PubChem CID 137030092) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[5-hydroxy-6-(hydroxyamino)-3-phenylquinolin-2-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[5-hydroxy-6-(hydroxyamino)-3-phenylquinolin-2-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 137030092 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | tert-butyl N-[1-[4-[5-hydroxy-6-(hydroxyamino)-3-phenylquinolin-2-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3nc4ccc(NO)c(O)c4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C30H31N3O4/c1-29(2,3)37-28(35)32-30(16-7-17-30)21-12-10-20(11-13-21)26-22(19-8-5-4-6-9-19)18-23-24(31-26)14-15-25(33-36)27(23)34/h4-6,8-15,18,33-34,36H,7,16-17H2,1-3H3,(H,32,35) |
| InChIKey | OJPTXMQFMQDRPE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|