C31H30IN3O2 — CID 89265260
tert-butyl N-[1-[4-[5-(iodoamino)-3-phenylcyclohepta[b]pyridin-2-yl]phenyl]cyclobutyl]carbamate (PubChem CID 89265260) has the molecular formula C31H30IN3O2 and a molecular weight of 603.50 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[5-(iodoamino)-3-phenylcyclohepta[b]pyridin-2-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[5-(iodoamino)-3-phenylcyclohepta[b]pyridin-2-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 89265260 |
| Molecular Formula | C31H30IN3O2 |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | tert-butyl N-[1-[4-[5-(iodoamino)-3-phenylcyclohepta[b]pyridin-2-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3nc4c(cc3-c3ccccc3)C(NI)=C=CC=C4)cc2)CCC1 |
| InChI | InChI=1S/C31H30IN3O2/c1-30(2,3)37-29(36)34-31(18-9-19-31)23-16-14-22(15-17-23)28-24(21-10-5-4-6-11-21)20-25-26(33-28)12-7-8-13-27(25)35-32/h4-8,10-12,14-17,20,35H,9,18-19H2,1-3H3,(H,34,36) |
| InChIKey | QELKTDZWYNLDFM-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|