C35H33N5O2 — CID 123720247
tert-butyl N-[1-[4-(4-phenyl-1,6,8,12-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13,15,17-octaen-5-yl)phenyl]cyclobutyl]carbamate (PubChem CID 123720247) has the molecular formula C35H33N5O2 and a molecular weight of 555.68 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-phenyl-1,6,8,12-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13,15,17-octaen-5-yl)phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(4-phenyl-1,6,8,12-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13,15,17-octaen-5-yl)phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 123720247 |
| Molecular Formula | C35H33N5O2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | tert-butyl N-[1-[4-(4-phenyl-1,6,8,12-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13,15,17-octaen-5-yl)phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3nc4c(cc3-c3ccccc3)-n3c(nc5ccccc53)CC=N4)cc2)CCC1 |
| InChI | InChI=1S/C35H33N5O2/c1-34(2,3)42-33(41)39-35(19-9-20-35)25-16-14-24(15-17-25)31-26(23-10-5-4-6-11-23)22-29-32(38-31)36-21-18-30-37-27-12-7-8-13-28(27)40(29)30/h4-8,10-17,21-22H,9,18-20H2,1-3H3,(H,39,41) |
| InChIKey | VQLHZWVBDFGYSI-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |