C16H12N2O2 — CID 11021744
2-(4-methylphenyl)-5-phenyl-1,3,4-oxadiazin-6-one (PubChem CID 11021744) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-phenyl-1,3,4-oxadiazin-6-one.
| Compound Name | 2-(4-methylphenyl)-5-phenyl-1,3,4-oxadiazin-6-one |
|---|---|
| PubChem CID | 11021744 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(4-methylphenyl)-5-phenyl-1,3,4-oxadiazin-6-one |
| SMILES | Cc1ccc(-c2nnc(-c3ccccc3)c(=O)o2)cc1 |
| InChI | InChI=1S/C16H12N2O2/c1-11-7-9-13(10-8-11)15-18-17-14(16(19)20-15)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | VWOWXMXWUJXILE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |