C16H13N3S — CID 14740710
6-methylsulfanyl-3,5-diphenyl-1,2,4-triazine (PubChem CID 14740710) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is 6-methylsulfanyl-3,5-diphenyl-1,2,4-triazine.
| Compound Name | 6-methylsulfanyl-3,5-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 14740710 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-methylsulfanyl-3,5-diphenyl-1,2,4-triazine |
| SMILES | CSc1nnc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3S/c1-20-16-14(12-8-4-2-5-9-12)17-15(18-19-16)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | RQTNRRZJEOVMCZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |