C11H10N4OS — CID 134891752
6-methylsulfanyl-5-nitroso-2-phenylpyrimidin-4-amine (PubChem CID 134891752) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 6-methylsulfanyl-5-nitroso-2-phenylpyrimidin-4-amine.
| Compound Name | 6-methylsulfanyl-5-nitroso-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 134891752 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 6-methylsulfanyl-5-nitroso-2-phenylpyrimidin-4-amine |
| SMILES | CSc1nc(-c2ccccc2)nc(N)c1N=O |
| InChI | InChI=1S/C11H10N4OS/c1-17-11-8(15-16)9(12)13-10(14-11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,12,13,14) |
| InChIKey | QJICUBFFFJZKHH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |