C11H8Cl2N4O2S — CID 170873702
4-amino-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidine-5-carboxylic acid (PubChem CID 170873702) has the molecular formula C11H8Cl2N4O2S and a molecular weight of 331.18 g/mol. Its IUPAC name is 4-amino-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 170873702 |
| Molecular Formula | C11H8Cl2N4O2S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-amino-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidine-5-carboxylic acid |
| SMILES | CSc1nc(-c2cc(Cl)nc(Cl)c2)nc(N)c1C(=O)O |
| InChI | InChI=1S/C11H8Cl2N4O2S/c1-20-10-7(11(18)19)8(14)16-9(17-10)4-2-5(12)15-6(13)3-4/h2-3H,1H3,(H,18,19)(H2,14,16,17) |
| InChIKey | FDWRPXSKQFBTLT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|