C16H11N3O — CID 582027
4-nitroso-2,6-diphenylpyrimidine (PubChem CID 582027) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-nitroso-2,6-diphenylpyrimidine.
| Compound Name | 4-nitroso-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 582027 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-nitroso-2,6-diphenylpyrimidine |
| SMILES | O=Nc1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H11N3O/c20-19-15-11-14(12-7-3-1-4-8-12)17-16(18-15)13-9-5-2-6-10-13/h1-11H |
| InChIKey | FYHWHJXVVXAQOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |