About 8-bromo-6-nitroquinoline;6-nitroquinoline
8-bromo-6-nitroquinoline;6-nitroquinoline (PubChem CID 159832810) has the molecular formula C18H11BrN4O4
and a molecular weight of 427.21 g/mol. Its IUPAC name is 8-bromo-6-nitroquinoline;6-nitroquinoline.
Molecular Properties
| Compound Name | 8-bromo-6-nitroquinoline;6-nitroquinoline |
| PubChem CID | 159832810 |
| Molecular Formula | C18H11BrN4O4 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 8-bromo-6-nitroquinoline;6-nitroquinoline |
| SMILES | O=[N+]([O-])c1cc(Br)c2ncccc2c1.O=[N+]([O-])c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H5BrN2O2.C9H6N2O2/c10-8-5-7(12(13)14)4-6-2-1-3-11-9(6)8;12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-5H;1-6H |
| InChIKey | NNRDGOAXTUAPPU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-6-nitroquinoline;6-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-nitroquinoline;6-nitroquinoline?
The IUPAC name of 8-bromo-6-nitroquinoline;6-nitroquinoline (CID 159832810) is 8-bromo-6-nitroquinoline;6-nitroquinoline.
What is the SMILES notation for 8-bromo-6-nitroquinoline;6-nitroquinoline?
The canonical SMILES for 8-bromo-6-nitroquinoline;6-nitroquinoline is O=[N+]([O-])c1cc(Br)c2ncccc2c1.O=[N+]([O-])c1ccc2ncccc2c1.
What is the InChIKey of 8-bromo-6-nitroquinoline;6-nitroquinoline?
The InChIKey is NNRDGOAXTUAPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2O2.C9H6N2O2/c10-8-5-7(12(13)14)4-6-2-1-3-11-9(6)8;12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-5H;1-6H.
What are the key properties of 8-bromo-6-nitroquinoline;6-nitroquinoline?
8-bromo-6-nitroquinoline;6-nitroquinoline has a molecular weight of 427.21 g/mol, XLogP of 5.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-nitroquinoline;6-nitroquinoline is sourced from PubChem (CID 159832810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).