C27H16N4O2 — CID 12986948
3-(3-nitrophenyl)-1-quinolin-2-yl-4,7-phenanthroline (PubChem CID 12986948) has the molecular formula C27H16N4O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-1-quinolin-2-yl-4,7-phenanthroline.
| Compound Name | 3-(3-nitrophenyl)-1-quinolin-2-yl-4,7-phenanthroline |
|---|---|
| PubChem CID | 12986948 |
| Molecular Formula | C27H16N4O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-(3-nitrophenyl)-1-quinolin-2-yl-4,7-phenanthroline |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3ccc4ccccc4n3)c3c(ccc4ncccc43)n2)c1 |
| InChI | InChI=1S/C27H16N4O2/c32-31(33)19-7-3-6-18(15-19)26-16-21(24-11-10-17-5-1-2-9-22(17)29-24)27-20-8-4-14-28-23(20)12-13-25(27)30-26/h1-16H |
| InChIKey | GMLPXGZQXRVCSE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|