About 7-nitro-1,2,4-benzotriazine
7-nitro-1,2,4-benzotriazine (PubChem CID 56997550) has the molecular formula C7H4N4O2
and a molecular weight of 176.14 g/mol. Its IUPAC name is 7-nitro-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 7-nitro-1,2,4-benzotriazine |
| PubChem CID | 56997550 |
| Molecular Formula | C7H4N4O2 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 7-nitro-1,2,4-benzotriazine |
| SMILES | O=[N+]([O-])c1ccc2ncnnc2c1 |
| InChI | InChI=1S/C7H4N4O2/c12-11(13)5-1-2-6-7(3-5)10-9-4-8-6/h1-4H |
| InChIKey | COKCGHOOEMAABP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-1,2,4-benzotriazine?
The IUPAC name of 7-nitro-1,2,4-benzotriazine (CID 56997550) is 7-nitro-1,2,4-benzotriazine.
What is the SMILES notation for 7-nitro-1,2,4-benzotriazine?
The canonical SMILES for 7-nitro-1,2,4-benzotriazine is O=[N+]([O-])c1ccc2ncnnc2c1.
What is the InChIKey of 7-nitro-1,2,4-benzotriazine?
The InChIKey is COKCGHOOEMAABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O2/c12-11(13)5-1-2-6-7(3-5)10-9-4-8-6/h1-4H.
What are the key properties of 7-nitro-1,2,4-benzotriazine?
7-nitro-1,2,4-benzotriazine has a molecular weight of 176.14 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-1,2,4-benzotriazine is sourced from PubChem (CID 56997550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).