C7H4N4O2 — CID 56997550
7-nitro-1,2,4-benzotriazine (PubChem CID 56997550) has the molecular formula C7H4N4O2 and a molecular weight of 176.14 g/mol. Its IUPAC name is 7-nitro-1,2,4-benzotriazine.
| Compound Name | 7-nitro-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 56997550 |
| Molecular Formula | C7H4N4O2 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 7-nitro-1,2,4-benzotriazine |
| SMILES | O=[N+]([O-])c1ccc2ncnnc2c1 |
| InChI | InChI=1S/C7H4N4O2/c12-11(13)5-1-2-6-7(3-5)10-9-4-8-6/h1-4H |
| InChIKey | COKCGHOOEMAABP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|